PRODUCT Properties
| Melting point: | 151.5-151.8 °C |
| Boiling point: | 297.7±35.0 °C(Predicted) |
| Density | 1.299±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Aqueous Acid (Slightly, Sonicated), Methanol (Very Slightly), Water (Slightly) |
| form | Solid |
| pka | 1.98±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C5H9NO4/c1-3(7)10-2-4(6)5(8)9/h4H,2,6H2,1H3,(H,8,9)/t4-/m0/s1 |
| InChIKey | VZXPDPZARILFQX-BYPYZUCNSA-N |
| SMILES | C(O)(=O)[C@H](COC(C)=O)N |
Description and Uses
O-Acetyl-L-serine is used in methods for identifying compounds for inhibiting COX-1, COX-2 and lipoxygenase for selective elimination of senescent cells.
