A7657412
Tetrachloroterephthalonitrile , 98% , 1897-41-2
CAS NO.：1897-41-2
Empirical Formula: C8Cl4N2
Molecular Weight: 265.91
MDL number: MFCD00059583
EINECS: 401-550-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB38.40 | In Stock |
|
| 100G | RMB141.60 | In Stock |
|
| 500g | RMB540.80 | In Stock |
|
| 2.5kg | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 308-312 °C(lit.) |
| Boiling point: | 370.1±42.0 °C(Predicted) |
| Density | 1.71±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol (Slightly) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C8Cl4N2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11 |
| InChIKey | TXRVDQMSXQKAPG-UHFFFAOYSA-N |
| SMILES | C1(C#N)=C(Cl)C(Cl)=C(C#N)C(Cl)=C1Cl |
| CAS DataBase Reference | 1897-41-2(CAS DataBase Reference) |
Description and Uses
Tetrachloroterephthalonitrile may be used to synthesize 2-aminotrifluoroterephthalonitriles.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 |
| Hazard Codes | Xi,N |
| Risk Statements | 43-53-50/53 |
| Safety Statements | 24-37-61-60 |
| RIDADR | 3077 |
| WGK Germany | 1 |
| RTECS | TI8275000 |
| HS Code | 2926.90.4801 |
| HazardClass | 9 |
| PackingGroup | III |
