BD8674831
Chlorthal , 97% , 2136-79-0
CAS NO.:2136-79-0
Empirical Formula: C8H2Cl4O4
Molecular Weight: 303.91
MDL number: MFCD00013974
EINECS: 256-495-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB29.60 | In Stock |
|
| 1g | RMB67.20 | In Stock |
|
| 5g | RMB232.80 | In Stock |
|
| 25g | RMB1031.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 330 °C (decomp)(Solv: acetic acid (64-19-7)) |
| Boiling point: | 425.2±45.0 °C(Predicted) |
| Density | 1.872±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 0.00±0.32(Predicted) |
| color | White |
| InChI | InChI=1S/C8H2Cl4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H,13,14)(H,15,16) |
| InChIKey | KZCBXHSWMMIEQU-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=C(Cl)C(Cl)=C(C(O)=O)C(Cl)=C1Cl |
| CAS DataBase Reference | 2136-79-0(CAS DataBase Reference) |
| EPA Substance Registry System | Chlorthal (2136-79-0) |
Description and Uses
Chlorthal is a residual benzoic acid herbicide for pre-emergent control of annual grasses and some annual broadleaved weeds.
2,3,5,6-Tetrachloroterephthalic Acid is a pest control chemical and plant growth regulator.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | C |
| RTECS | CZ4400000 |
| HS Code | 2922498590 |






