A7657712
2,2′:5′,2′′-Terthiophene , 99% , 1081-34-1
Synonym(s):
α-Terthienyl;2,5-Di(2-thienyl)thiophene
CAS NO.:1081-34-1
Empirical Formula: C12H8S3
Molecular Weight: 248.39
MDL number: MFCD00012167
EINECS: 640-441-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB113.60 | In Stock |
|
| 25G | RMB527.20 | In Stock |
|
| 100G | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-95 °C(lit.) |
| Boiling point: | 160 °C (0.1 mmHg) |
| Density | 1.4602 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| Flash point: | 160°C/0.1mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Light Yellow |
| Water Solubility | Insoluble in water. |
| Merck | 14,9174 |
| BRN | 178604 |
| InChI | InChI=1S/C12H8S3/c1-3-9(13-7-1)11-5-6-12(15-11)10-4-2-8-14-10/h1-8H |
| InChIKey | KXSFECAJUBPPFE-UHFFFAOYSA-N |
| SMILES | C1(C2SC(C3SC=CC=3)=CC=2)SC=CC=1 |
| CAS DataBase Reference | 1081-34-1(CAS DataBase Reference) |
| EPA Substance Registry System | .alpha.-Terthiophene (1081-34-1) |
Description and Uses
2,2'':5'',2''''-Terthiophene is a thiophene compound isolated from the roots of Echinops transiliensis, and was studied for its larvicidal activity against Aedes aegypti. 2,2'':5'',2''''-Terthiophene also showed inhibitory effects on dispersal ability of Bursaphelenchus xylophilus when used synergistically with certain antibiotics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | WZ9717750 |
| F | 8-10 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |





![5''-Bromo-[2,2':5',2''-terthiophene]-5-carbaldehyde](https://img.chemicalbook.com/CAS/GIF/161726-69-8.gif)
