A7657812
o-Tolylboronic acid , 98% , 16419-60-6
Synonym(s):
2-Methylphenylboronic acid;2-Tolueneboronic acid;(2-Tolyl)boronic acid;o-Boronotoluene;o-Methylphenylboronic acid
CAS NO.:16419-60-6
Empirical Formula: C7H9BO2
Molecular Weight: 135.96
MDL number: MFCD00093526
EINECS: 605-351-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB69.60 | In Stock |
|
| 100G | RMB259.20 | In Stock |
|
| 500g | RMB1220.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-164 °C(lit.) |
| Boiling point: | 283.4±33.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 8.61±0.58(Predicted) |
| form | Crystalline Powder |
| color | Beige |
| Water Solubility | Slightly soluble in water. |
| BRN | 2935796 |
| InChI | InChI=1S/C7H9BO2/c1-6-4-2-3-5-7(6)8(9)10/h2-5,9-10H,1H3 |
| InChIKey | NSJVYHOPHZMZPN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C)(O)O |
| CAS DataBase Reference | 16419-60-6(CAS DataBase Reference) |
Description and Uses
2-Methylbenzeneboronic acid is a reagent used for Pd-catalyzed arylation using Suzuki-Miyaura cross-coupling in water, Ruthenium catalyzed direct arylation reactions, Ligand-free copper-catalyzed coupling reactions, Rhodium-catalyzed asymmetric 1,4-addition reactions. Reagent used in Preparation of chiral monophosphorus ligands in asymmetric Suzuki-Miyaura coupling reaction, Human farnesyl pyrophosphate synthase inhibitors as antitumor agents for multiple myeloma cells
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | ED7777777 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






