PRODUCT Properties
| Melting point: | 81-86 °C(lit.) |
| Boiling point: | 311.39°C (rough estimate) |
| Density | 1.4528 (rough estimate) |
| refractive index | 1.4336 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.24(at 25℃) |
| color | White to Off-White |
| Water Solubility | Soluble in water, and ethanol. |
| BRN | 1759502 |
| InChI | InChI=1S/C6H10O4/c1-4(2-5(7)8)3-6(9)10/h4H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | XJMMNTGIMDZPMU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CC(C)CC(O)=O |
| CAS DataBase Reference | 626-51-7(CAS DataBase Reference) |
Description and Uses
3-Methylglutaric Acid is used in preparation method of high-adhesion super weather-resistant powder coating.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29171900 |
| Storage Class | 11 - Combustible Solids |






