A7664158
7-Hydroxyflavone , 10mMinDMSO , 6665-86-7
Synonym(s):
7-Hydroxy-2-phenyl-4H-1-benzopyran-4-one;NSC 94258
CAS NO.：6665-86-7
Empirical Formula: C15H10O3
Molecular Weight: 238.24
MDL number: MFCD00006835
EINECS: 229-705-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-247 °C (lit.) |
| Boiling point: | 320.83°C (rough estimate) |
| Density | 1.340±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5740 (estimate) |
| Water Solubility | Insoluble in water |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 7.02±0.40(Predicted) |
| color | White to Light yellow |
| BRN | 194089 |
| InChI | 1S/C15H10O3/c16-11-6-7-12-13(17)9-14(18-15(12)8-11)10-4-2-1-3-5-10/h1-9,16H |
| InChIKey | MQGPSCMMNJKMHQ-UHFFFAOYSA-N |
| SMILES | Oc1ccc2C(=O)C=C(Oc2c1)c3ccccc3 |
| LogP | 3.620 |
| CAS DataBase Reference | 6665-86-7(CAS DataBase Reference) |
Description and Uses
antifungal, analgesic
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
