A7664258
Ethosuximide , 10mMinDMSO , 77-67-8
Synonym(s):
2-Ethyl-2-methylsuccinimide;Ethosuximide
CAS NO.:77-67-8
Empirical Formula: C7H11NO2
Molecular Weight: 141.17
MDL number: MFCD00072123
EINECS: 201-048-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51 °C |
| Boiling point: | 150 °C / 12mmHg |
| Density | 1.1522 (rough estimate) |
| refractive index | 1.5026 (estimate) |
| storage temp. | 2-8°C |
| solubility | ethanol: 100 mg/mL |
| pka | pKa 9.5 (Uncertain) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 190g/L(25 ºC) |
| Merck | 14,3748 |
| BCS Class | 1,3 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | InChI=1S/C7H11NO2/c1-3-7(2)4-5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10) |
| InChIKey | HAPOVYFOVVWLRS-UHFFFAOYSA-N |
| SMILES | N1C(=O)CC(CC)(C)C1=O |
| CAS DataBase Reference | 77-67-8 |
Description and Uses
cholinergic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-39/23/24/25-23/24/25-11 |
| Safety Statements | 36-45-36/37-16-7 |
| WGK Germany | 3 |
| RTECS | WN2800000 |
| HS Code | 2925190100 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 77-67-8(Hazardous Substances Data) |
| Toxicity | LD50 in mice (g/kg): 1.65 i.p.; 1.75 orally (Najer) |




