A7670712
3,4,4'-Trichlorocarbanilide , 98% , 101-20-2
Synonym(s):
1-(4-Chlorophenyl)-3-(3,4-dichlorophenyl)urea;3,4,4′-Trichlorocarbanilide;TCC;Triclocarban
CAS NO.:101-20-2
Empirical Formula: C13H9Cl3N2O
Molecular Weight: 315.58
MDL number: MFCD00013254
EINECS: 202-924-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB55.20 | In Stock |
|
| 500G | RMB207.20 | In Stock |
|
| 2.5kg | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254-256 °C (lit.) |
| Boiling point: | 344.2±42.0 °C(Predicted) |
| Density | 1.5732 (rough estimate) |
| vapor pressure | <0.1 mm Hg ( 25 °C) |
| refractive index | 1.6300 (estimate) |
| Flash point: | 150 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | methanol: soluble |
| pka | 12.77±0.70(Predicted) |
| form | Solid |
| color | Fine plates |
| Water Solubility | <0.1 g/100 mL at 26 ºC |
| Merck | 14,9654 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents strong bases. |
| Major Application | environmental |
| Cosmetics Ingredients Functions | ANTIMICROBIAL DEODORANT PRESERVATIVE |
| InChI | 1S/C13H9Cl3N2O/c14-8-1-3-9(4-2-8)17-13(19)18-10-5-6-11(15)12(16)7-10/h1-7H,(H2,17,18,19) |
| InChIKey | ICUTUKXCWQYESQ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| LogP | 3.633 at 25℃ |
| CAS DataBase Reference | 101-20-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4,4'-Trichloro carbanilide(101-20-2) |
| EPA Substance Registry System | Triclocarban (101-20-2) |
Description and Uses
Used as bacteriostat and antiseptic in soaps and other cleansing compositions. Antiseptic, disinfectant.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | FE1250000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 38220090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 101-20-2(Hazardous Substances Data) |
| Toxicity | LD50 ipr-mus: 2100 mg/kg LPPTAK 27,306,79 |




