A7670912
3-(Trifluoromethoxy)benzoic acid , 98% , 1014-81-9
CAS NO.:1014-81-9
Empirical Formula: C8H5F3O3
Molecular Weight: 206.12
MDL number: MFCD00041501
EINECS: 213-802-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB42.40 | In Stock |
|
| 5G | RMB128.00 | In Stock |
|
| 25G | RMB233.60 | In Stock |
|
| 100G | RMB853.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89-92 °C (lit.) |
| Boiling point: | 203°C (rough estimate) |
| Density | 1.4251 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 3.82±0.10(Predicted) |
| form | Powder |
| color | White |
| BRN | 2579574 |
| InChI | InChI=1S/C8H5F3O3/c9-8(10,11)14-6-3-1-2-5(4-6)7(12)13/h1-4H,(H,12,13) |
| InChIKey | OKPFIWIMBJNFSE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 1014-81-9(CAS DataBase Reference) |
| NIST Chemistry Reference | M-trifluoromethoxybenzoic acid(1014-81-9) |
Description and Uses
Kinetics of internal acyl migration and hydrolysis of the synthetic β-1-O-acyl-
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-R36/37/38 |
| Safety Statements | 26-36-37/39-S37/39-S26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







