A7913712
4'-(Trifluoromethoxy)acetophenone , >98.0%(GC) , 85013-98-5
CAS NO.：85013-98-5
Empirical Formula: C9H7F3O2
Molecular Weight: 204.15
MDL number: MFCD00042404
EINECS: 285-066-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25g | RMB100.00 | In Stock |
|
| 100g | RMB334.40 | In Stock |
|
| 500g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100 °C |
| Density | 1.278 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 190 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| Specific Gravity | 1.278 |
| color | Yellow to light brown |
| BRN | 5930486 |
| InChI | 1S/C9H7F3O2/c1-6(13)7-2-4-8(5-3-7)14-9(10,11)12/h2-5H,1H3 |
| InChIKey | MOEXTBIPPMLEFX-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OC(F)(F)F)cc1 |
| CAS DataBase Reference | 85013-98-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1-[4-(trifluoromethoxy)phenyl]-(85013-98-5) |
Description and Uses
4′-(Trifluoromethoxy)acetophenone is an organic building block. It is also referred as p-(trifluoromethoxy)acetophenone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319 |
| Precautionary statements | P210e-P280a-P370+P378a-P501a-P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-23-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |
