A7798112
3-(Trifluoromethoxy)aniline , ≥98.0% , 1535-73-5
CAS NO.：1535-73-5
Empirical Formula: C7H6F3NO
Molecular Weight: 177.12
MDL number: MFCD00041511
EINECS: 216-256-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB30.40 | In Stock |
|
| 25G | RMB91.20 | In Stock |
|
| 100G | RMB341.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 72-73 °C8 mm Hg(lit.) |
| Density | 1.325 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 3.36±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.325 |
| color | Clear yellow to orange |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 776921 |
| InChI | InChI=1S/C7H6F3NO/c8-7(9,10)12-6-3-1-2-5(11)4-6/h1-4H,11H2 |
| InChIKey | SADHVOSOZBAAGL-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 1535-73-5(CAS DataBase Reference) |
Description and Uses
3-(Trifluoromethoxy)aniline is reactant in the synthesis of pyrazolone-quinazolone hybrids as human hydroxyphenylpyruvate dioxygenase inhibitors which is a potential treatment for type I tyrosinemia.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-27-36/37/39-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| HazardClass | IRRITANT, TOXIC |
| HS Code | 29222900 |
