A7673212
Thymidine , 99% , 50-89-5
Synonym(s):
Thymidine;dT;2′-Deoxythymidine;Thymidine - CAS 50-89-5 - Calbiochem;Thymine deoxyriboside
CAS NO.:50-89-5
Empirical Formula: C10H14N2O5
Molecular Weight: 242.23
MDL number: MFCD00006537
EINECS: 200-070-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB50.40 | In Stock |
|
| 25G | RMB94.40 | In Stock |
|
| 100G | RMB312.80 | In Stock |
|
| 500g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-188 °C(lit.) |
| alpha | 18.6 º (c=3, H2O) |
| Boiling point: | 385.05°C (rough estimate) |
| Density | 1.3129 (rough estimate) |
| refractive index | 33 ° (C=1, 1mol/L NaOH) |
| storage temp. | 2-8°C |
| solubility | Acetone, DMSO (Slightly), Ethanol, Ethyl Acetate, Methanol (Slightly, Heated), P |
| form | Crystalline Powder |
| pka | pK1:9.79;pK2:12.85 (25°C) |
| color | White to almost white |
| PH | 9.8 |
| biological source | synthetic (organic) |
| optical activity | [α]20/D +19±1°, c = 1% in H2O |
| Water Solubility | SOLUBLE |
| λmax | 267 (pH 7);267 (pH 13) |
| Merck | 14,9397 |
| BRN | 89285 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1 |
| InChIKey | IQFYYKKMVGJFEH-XLPZGREQSA-N |
| SMILES | CC1=CN([C@H]2C[C@H](O)[C@@H](CO)O2)C(=O)NC1=O |
| LogP | -0.930 |
| CAS DataBase Reference | 50-89-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Thymidine(50-89-5) |
| EPA Substance Registry System | Thymidine (50-89-5) |
Description and Uses
Thymidine is a pyrimidine nucleoside that is composed of the pyrimidine base thymine attached to the sugar deoxyribose. As a constituent of DNA, thymidine pairs with adenine in the DNA double helix. In cell biology it is used to synchronize the cells in G1/early S phase.
Thymidine is used in the syntheses of active pharmaceutical ingredient such as zidovudine. It also pairs with deoxyadenosine in double-stranded deoxyribonucleic acid. It is used to synchronize the cells in G1/early S phase in cell biology.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-40-36/37/38-68 |
| Safety Statements | 22-24/25-37/39-26-36/37/39 |
| WGK Germany | 3 |
| RTECS | XP2071000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |


