PRODUCT Properties
| Melting point: | 130°C (dec.) |
| Boiling point: | 595.4±50.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| pka | 12.04±0.70(Predicted) |
| form | powder |
| color | White to Off-White |
| biological source | animal (crustaceans) |
| Water Solubility | water: 50mg/mL, clear, colorless to faintly yellow |
| BRN | 1346524 |
| Stability: | Hygroscopic |
| InChI | 1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5+,6-,7-,8+/m1/s1 |
| InChIKey | MBLBDJOUHNCFQT-YWIQKCBGSA-N |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| CAS DataBase Reference | 7772-94-3(CAS DataBase Reference) |
| EPA Substance Registry System | .beta.-D-Mannopyranose, 2-(acetylamino)-2-deoxy- (7772-94-3) |
Description and Uses
A derivative of D-Mannosamine (M167000).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29329985 |
| Storage Class | 11 - Combustible Solids |





