A7676758
ForsythosideB , 10mMinDMSO , 81525-13-5
CAS NO.:81525-13-5
Empirical Formula: C34H44O19
Molecular Weight: 756.7
MDL number: MFCD03424245
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 1040.3±65.0 °C(Predicted) |
| Density | 1.65 |
| storage temp. | 2-8°C |
| solubility | Methanol (Slightly) |
| form | Solid |
| pka | 9.31±0.10(Predicted) |
| color | Off-White to Light Brown |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChIKey | JMBINOWGIHWPJI-MJJXKKHKNA-N |
| SMILES | O1[C@H]([C@@H]([C@@](C1)(O)CO)O)OC[C@H]2O[C@H]([C@@H]([C@H]([C@@H]2OC(=O)\C=C\c5cc(c(cc5)O)O)O[C@@H]4O[C@H]([C@@H]([C@H]([C@H]4O)O)O)C)O)OCCc3cc(c(cc3)O)O |
Description and Uses
Forsythoside B is an anti-inflammatory agent protecting against such effects such as sepsis. Neuroprotective agent.
Safety
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |




