PRODUCT Properties
| Melting point: | approximate 157℃ |
| Boiling point: | 730.4±60.0 °C(Predicted) |
| Density | 1.361±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.81±0.70(Predicted) |
| color | Off-White to Pale Beige |
| Major Application | food and beverages |
| InChIKey | KFFCKOBAHMGTMW-LGQRSHAYSA-N |
| SMILES | O[C@@H]([C@H](O)[C@@H](CO)O1)[C@@H](O)[C@@H]1OC(C=C2)=C(OC)C=C2[C@H]3OC[C@]4([H])[C@@H](OC[C@@]43[H])C5=CC(OC)=C(OC)C=C5 |
Description and Uses
Phillyrin is a natural lignan compound attenuating tumor necrosis factor secreted from macrophages, that play an inportant role in adipocyte dysfunctions. Anti-obesity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
