A7684512
1-(p-Toluenesulfonyl)imidazole , 99% , 2232-08-8
Synonym(s):
1-Tosylimidazole
CAS NO.：2232-08-8
Empirical Formula: C10H10N2O2S
Molecular Weight: 222.26
MDL number: MFCD00005285
EINECS: 218-771-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB55.20 | In Stock |
|
| 100G | RMB207.20 | In Stock |
|
| 500g | RMB1025.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78 °C(lit.) |
| Boiling point: | 409.1±38.0 °C(Predicted) |
| Density | 1.3038 (rough estimate) |
| refractive index | 1.5650 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | chloroform: soluble25mg/mL, clear, colorless to faintly yellow |
| form | Crystals or Crystalline Powder |
| pka | 1.22±0.10(Predicted) |
| color | White to slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 612451 |
| InChI | InChI=1S/C10H10N2O2S/c1-9-2-4-10(5-3-9)15(13,14)12-7-6-11-8-12/h2-8H,1H3 |
| InChIKey | YJYMYJRAQYREBT-UHFFFAOYSA-N |
| SMILES | C1N(S(C2=CC=C(C)C=C2)(=O)=O)C=CN=1 |
| CAS DataBase Reference | 2232-08-8(CAS DataBase Reference) |
Description and Uses
1-(p-Toluenesulfonyl)imidazole was used in the synthesis of cationic water soluble cyclodextrin, mono-6A-(1-butyl-3-imidazolium)-6A-deoxy-β-cyclodextrin chloride (BIMCD), useful in chiral separation of amino acids and anionic pharmaceuticals by capillary electrophoresis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29332900 |
