A7684712
O-(N-Succinimidyl)-N,N,N',N'-tetramethyluronium Tetrafluoroborate , 97% , 105832-38-0
Synonym(s):
O-(N-Succinimidyl)-N,N,N′,N′-tetramethyluronium tetrafluoroborate;N,N,N′,N′-Tetramethyl-O-(N-succinimidyl)uronium tetrafluoroborate;O-[N-Succinimidyl)-1,1,3,3-tetramethyluronium tetrafluoroborate;TSTU
CAS NO.:105832-38-0
Empirical Formula: C9H16BF4N3O3
Molecular Weight: 301.05
MDL number: MFCD00077875
EINECS: 629-651-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB102.40 | In Stock |
|
| 100G | RMB351.20 | In Stock |
|
| 500g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-201 °C(lit.) |
| Density | 1.41 g/cm |
| storage temp. | 2-8°C |
| solubility | acetonitrile: 0.1 g/mL, clear |
| form | Crystalline Powder or Needles |
| color | White to off-white |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C9H16N3O3.BF4/c1-10(2)9(11(3)4)15-12-7(13)5-6-8(12)14;2-1(3,4)5/h5-6H2,1-4H3;/q+1;-1 |
| InChIKey | BVYYWTQJMFGHLU-UHFFFAOYSA-M |
| SMILES | [B+3]([F-])([F-])([F-])[F-].O(N1C(CCC1=O)=O)/C(=[N+](\C)/C)/N(C)C |
| CAS DataBase Reference | 105832-38-0(CAS DataBase Reference) |
Description and Uses
Reagent for the clean in-situ formation of N-succinimidyl active esters
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29280000 |







