A7691058
4-NitroquinolineN-oxide , 10mMinDMSO , 56-57-5
Synonym(s):
4-Nitroquinoline 1-oxide;4-NQO
CAS NO.：56-57-5
Empirical Formula: C9H6N2O3
Molecular Weight: 190.16
MDL number: MFCD00006738
EINECS: 200-281-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-156 °C(lit.) |
| Boiling point: | 325.64°C (rough estimate) |
| Density | 1.42 |
| refractive index | 1.5570 (estimate) |
| storage temp. | -20°C |
| solubility | acetone: clear to hazy |
| pka | -1.83±0.10(Predicted) |
| form | Crystalline Solid |
| color | yellow to brown |
| BRN | 165756 |
| Stability: | Stable. Hygroscopic, light-sensitive. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C9H6N2O3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6H |
| InChIKey | YHQDZJICGQWFHK-UHFFFAOYSA-N |
| SMILES | N(C1=CC=N(C2C=CC=CC=21)=O)(=O)=O |
| CAS DataBase Reference | 56-57-5(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Nitroquinoline 1-oxide (56-57-5) |
Description and Uses
4-Nitroquinoline N-oxide has been used as a model compound to study its carcinogenic effects.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H350 |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 45-68-40-20/21/22 |
| Safety Statements | 53-45-36/37-22 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | VC2100000 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29339900 |
| Hazardous Substances Data | 56-57-5(Hazardous Substances Data) |
| Toxicity | LD50 intraperitoneal in mouse: 190mg/kg |
