A7692358
N-Acetyl-DL-methionine , 10mMinDMSO , 1115-47-5
Synonym(s):
N-Acetyl-DL -methionine;Methionamine
CAS NO.：1115-47-5
Empirical Formula: C7H13NO3S
Molecular Weight: 191.25
MDL number: MFCD00008681
EINECS: 214-224-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C(lit.) |
| Boiling point: | 453.6±40.0 °C(Predicted) |
| Density | 1.2684 (rough estimate) |
| refractive index | 1.6370 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.50±0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | Soluble in water, ethanol, ethyl acetate. |
| Merck | 14,96 |
| BRN | 1725554 |
| InChI | InChI=1S/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 |
| InChIKey | XUYPXLNMDZIRQH-LURJTMIESA-N |
| SMILES | C(O)(=O)[C@H](CCSC)NC(C)=O |
| CAS DataBase Reference | 1115-47-5(CAS DataBase Reference) |
| EPA Substance Registry System | Methionine, N-acetyl- (1115-47-5) |
Description and Uses
N-acetylmethionine is a methionine derivative that is methionine in which one of the amine hydrogens is substituted by an acetyl group.It is a conjugate acid of a N-acetylmethioninate.
N-Acetyl-DL-methionine is used as pharmaceutical intermediate, biochemical reagent.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | PD0500000 |
| TSCA | Yes |
| HS Code | 29309070 |
