A7694312
Trimethylphenylammonium tribromide , 97% , 4207-56-1
Synonym(s):
Phenyltrimethylammonium bromide dibromide;Phenyltrimethylammonium bromide-perbromide;Phenyltrimethylammonium tribromide
CAS NO.：4207-56-1
Empirical Formula: C9H14Br3N-2
Molecular Weight: 375.93
MDL number: MFCD00011789
EINECS: 224-127-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB122.40 | In Stock |
|
| 50g | RMB415.20 | In Stock |
|
| 100G | RMB428.80 | In Stock |
|
| 250g | RMB1599.20 | In Stock |
|
| 500g | RMB2109.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-115 °C (dec.) (lit.) |
| Density | 2.2071 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | ethanol: 10 mg/mL hot, clear |
| form | Crystalline Powder |
| color | Orange |
| Water Solubility | Insoluble |
| Sensitive | Hygroscopic |
| BRN | 3919459 |
| InChI | InChI=1S/C9H14N.Br3/c1-10(2,3)9-7-5-4-6-8-9;1-3-2/h4-8H,1-3H3;/q+1;-1 |
| InChIKey | PRXNKYBFWAWBNZ-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1)[N+](C)(C)C.[Br-](Br)Br |
| CAS DataBase Reference | 4207-56-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenaminium, N,N,N-trimethyl-, (tribromide) (4207-56-1) |
Description and Uses
Phenyltrimethylammonium tribromide is used as brominating reagent for 1,2-addition of bromine to the double bond of α,β-unsaturated compounds.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 6.1(b) |
| PackingGroup | II |
| HS Code | 29239000 |
