A7696812
Triethyl 2-phosphonopropionate , 97% , 3699-66-9
Synonym(s):
2-(Diethoxyphosphoryl)propionic acid ethyl ester
CAS NO.:3699-66-9
Empirical Formula: C9H19O5P
Molecular Weight: 238.22
MDL number: MFCD00009159
EINECS: 223-033-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB160.00 | In Stock |
|
| 100G | RMB577.60 | In Stock |
|
| 500g | RMB2600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161-164° |
| Boiling point: | 143-144 °C12 mm Hg(lit.) |
| Density | 1.111 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 192 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Miscible with chloroform and methanol. |
| form | Liquid |
| Specific Gravity | 1.111 |
| color | Clear colorless |
| BRN | 1786994 |
| InChI | InChI=1S/C9H19O5P/c1-5-12-9(10)8(4)15(11,13-6-2)14-7-3/h8H,5-7H2,1-4H3 |
| InChIKey | BVSRWCMAJISCTD-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(P(OCC)(OCC)=O)C |
| CAS DataBase Reference | 3699-66-9(CAS DataBase Reference) |
Description and Uses
Triethyl 2-phosphonopropionate is used as a reactant in intramolecular conjugate addition for the synthesis of floresolide B, enantioselective synthesis of spiroindane di-methyl acetic acid and in stereo selective intramolecular Diels-Alder reactions. It plays an important role in Horner-Wadsworth-Emmons reactions and chemoenzymatic one-pot synthesis of gamma-butyrolactones. It is also used in the preparation of 3-[2]furyl-2-methyl-acrylic acid ethyl ester by reacting with furfural.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-38-37-36 |
| Safety Statements | 23-24/25-36-26-39-37 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| HS Code | 29319019 |
| Storage Class | 10 - Combustible liquids |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







