PRODUCT Properties
| Melting point: | 150-153 °C(lit.) |
| Boiling point: | 211.61°C (rough estimate) |
| alpha | -73~-77°(D/20℃)(c=4,H2O,24hr) |
| Density | 1.1738 (rough estimate) |
| refractive index | -75.5 ° (C=10, H2O) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| pka | 12.50±0.20(Predicted) |
| form | Powder |
| color | Beige to light brown to purple-grayish |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Merck | 14,4279 |
| BRN | 1723321 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| Cosmetic Ingredient Review (CIR) | L-Fucose (2438-80-4) |
| InChI | 1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4+,5+,6-/m0/s1 |
| InChIKey | SHZGCJCMOBCMKK-DLABPRKASA-N |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C=O |
| LogP | -0.340 (est) |
| CAS DataBase Reference | 2438-80-4(CAS DataBase Reference) |
| EPA Substance Registry System | L-Galactose, 6-deoxy- (2438-80-4) |
Description and Uses
L-(−)-Fucose is a deoxyhexose monosaccharide found on N- and O-linked glycans and glycolipids of a wide variety of organisms. It can exist as a terminal modification of glycan structures or serve as a point of attachment for adding other sugars. In humans, L-(−)-fucose plays a role in A and B blood group antigen substructure determination, selectin-mediated leukocyte-endothelial adhesion, and host-microbe interactions.
L-Fucose was isolated from seaweed. It finds application in cosmetics, pharmaceuticals and dietary supplements. It is used in the determination of antigen in A and B blood group. It is also used in the selection-mediated leukocyte-endothelial adhesion and host-microbe interactions. L-Fucose is also used in anti aging creams as well as to promote the accelerated healing of wounds and to reduce allergy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |





