A7699212
Trimethylphenylammonium chloride , 98% , 138-24-9
Synonym(s):
Phenyltrimethylammonium chloride;Trimethylphenylammonium chloride
CAS NO.:138-24-9
Empirical Formula: C9H14ClN
Molecular Weight: 171.67
MDL number: MFCD00011790
EINECS: 205-319-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 246-248 °C (dec.) (lit.) |
| Boiling point: | 283.2°C (rough estimate) |
| Density | 1.0683 (rough estimate) |
| bulk density | 540kg/m3 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.6224 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | H2O: 0.1 g/mL, clear |
| form | Solid |
| color | White crystalline |
| PH Range | 4.5 |
| PH | 4.5 (333g/l, H2O, 20℃) |
| explosive limit | 1-6%(V) |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 3572527 |
| InChI | 1S/C9H14N.ClH/c1-10(2,3)9-7-5-4-6-8-9;/h4-8H,1-3H3;1H/q+1;/p-1 |
| InChIKey | MQAYPFVXSPHGJM-UHFFFAOYSA-M |
| SMILES | [Cl-].C[N+](C)(C)c1ccccc1 |
| LogP | 0.542 at 25℃ |
| CAS DataBase Reference | 138-24-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Trimethylphenylammonium chloride(138-24-9) |
| EPA Substance Registry System | Benzenaminium, N,N,N-trimethyl-, chloride (138-24-9) |
Description and Uses
Phenyltrimethylammonium chloride is an effective phase transfer catalyst, methylating agent, also useful for alkaline depolymerizations, corrosion inhibitor for low carbon steel.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311-H412 |
| Precautionary statements | P264-P270-P273-P280-P301+P310-P302+P352+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 24/25 |
| Safety Statements | 53-25-39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 1 |
| RTECS | BT2190000 |
| Autoignition Temperature | 237°C |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Chronic 3 |
| Toxicity | LD50 orally in Rabbit: 121 mg/kg LD50 dermal Rabbit 309 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






