A7705912
1,3,5-Trimethylpyrazole , 97% , 1072-91-9
CAS NO.：1072-91-9
Empirical Formula: C6H10N2
Molecular Weight: 110.16
MDL number: MFCD00015536
EINECS: 626-960-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB79.20 | In Stock |
|
| 100G | RMB271.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-41 °C (lit.) |
| Boiling point: | 168-170 °C |
| Density | 0.93 |
| refractive index | 1.4589 |
| Flash point: | 93 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 3.30±0.10(Predicted) |
| color | White or Colorless to Light yellow |
| λmax | 220nm(MeOH)(lit.) |
| BRN | 110515 |
| InChI | InChI=1S/C6H10N2/c1-5-4-6(2)8(3)7-5/h4H,1-3H3 |
| InChIKey | HNOQAFMOBRWDKQ-UHFFFAOYSA-N |
| SMILES | N1(C)C(C)=CC(C)=N1 |
| CAS DataBase Reference | 1072-91-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,5-Trimethylpyrazole(1072-91-9) |
Description and Uses
1,3,5-Trimethylpyrazole is a compound used for chemical synthesis[1].
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1325 4.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29331990 |
| Limited Quantities | 5.0 Kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
