A7706958
MethacholineChloride , 10mMinDMSO , 62-51-1
Synonym(s):
(2-Acetoxypropyl)trimethylammonium chloride;Acetyl-β-methylcholine chloride;Methacholine chloride
CAS NO.:62-51-1
Empirical Formula: C8H18ClNO2
Molecular Weight: 195.69
MDL number: MFCD00011817
EINECS: 200-537-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-173 °C(lit.) |
| Density | 1.1028 (rough estimate) |
| refractive index | 1.5790 (estimate) |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | powder |
| color | White to Almost white |
| PH | 3.0~7.0 (50g/l, 25℃) |
| Water Solubility | almost transparency |
| Merck | 14,5940 |
| BRN | 4162373 |
| Stability: | Unstable - moisture sensitive. Incompatible with oxidizing agents. |
| InChI | 1S/C8H18NO2.ClH/c1-7(11-8(2)10)6-9(3,4)5;/h7H,6H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | JHPHVAVFUYTVCL-UHFFFAOYSA-M |
| SMILES | [Cl-].CC(C[N+](C)(C)C)OC(C)=O |
| LogP | -3.957 (est) |
| CAS DataBase Reference | 62-51-1 |
| EPA Substance Registry System | 1-Propanaminium, 2-(acetyloxy)-N,N,N-trimethyl-, chloride (62-51-1) |
Description and Uses
Acetyl-β-methylcholine (methacholine), an analog of acetylcholine, is use as a receptor agonist to study processes such as airway hyperresponsiveness associated with asthma.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | BR5250000 |
| F | 3-10-21 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






