A7708458
L-Rhamnosemonohydrate , 10mMinDMSO , 10030-85-0
CAS NO.:10030-85-0
Empirical Formula: C6H14O6
Molecular Weight: 182.17
MDL number: MFCD00149363
EINECS: 600-058-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-95 °C(lit.) |
| alpha | 8.2 º (c=4.5,H2O) |
| Density | 1.47 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Crystals or Crystalline Powder |
| color | White |
| Odor | Odorless |
| PH Range | 7.8 - 8.6 |
| biological source | oranges |
| optical activity | [α]20/D +8±0.5°, 2 hr, c = 5% in H2O |
| Water Solubility | 300 g/L (20 ºC) |
| Merck | 14,8172 |
| BRN | 5988592 |
| Stability: | Stable at RT |
| Major Application | microbiology |
| Cosmetics Ingredients Functions | HUMECTANT FRAGRANCE |
| InChI | 1S/C6H12O5.H2O/c1-2-3(7)4(8)5(9)6(10)11-2;/h2-10H,1H3;1H2/t2-,3-,4+,5+,6+;/m0./s1 |
| InChIKey | BNRKZHXOBMEUGK-FGASXDGJSA-N |
| SMILES | O.C[C@@H]1O[C@@H](O)[C@H](O)[C@H](O)[C@H]1O |
| CAS DataBase Reference | 10030-85-0(CAS DataBase Reference) |
Description and Uses
Composition of plum leaf polysaccharides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 24/25-37/39-26 |
| WGK Germany | 3 |
| F | 3 |
| TSCA | Yes |
| HS Code | 29400010 |
| Storage Class | 11 - Combustible Solids |




