A7710158
Fenretinide , 10mMinDMSO , 65646-68-6
Synonym(s):
HPR;Fenretinide;Fenretinide, 4HPR, N-(4-Hydroxyphenyl)-all- trans Retinamide;Haptoglobin-related protein;4-HPR
CAS NO.:65646-68-6
Empirical Formula: C26H33NO2
Molecular Weight: 391.55
MDL number: MFCD00792674
EINECS: 200-256-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-163°C |
| Boiling point: | 597.6±42.0 °C(Predicted) |
| Density | 1.081±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Orange solid |
| pka | 9.98±0.26(Predicted) |
| color | Yellow |
| biological source | synthetic (organic) |
| λmax | 362nm(MeOH)(lit.) |
| Merck | 14,3998 |
| Stability: | Light Sensitive - Protect from Light Exposure |
| InChIKey | AKJHMTWEGVYYSE-FXILSDISSA-N |
| SMILES | C(NC1=CC=C(O)C=C1)(=O)/C=C(/C=C/C=C(/C=C/C1C(C)(C)CCCC=1C)\C)\C |
| CAS DataBase Reference | 65646-68-6(CAS DataBase Reference) |
Description and Uses
4-HYDROXYPHENYLRETINAMIDE is an effective agent for the chemoprevention and growth modulation of oncogene-induced prostate cancer in the mouse prostate reconstitution model system and may be effective for the chemoprevention of human prostate cancer
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H319-H335-H360 |
| Precautionary statements | P201-P280-P301+P312+P330-P302+P352+P312-P304+P340+P312-P308+P313 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 60-61-20/21/22-36/37/38 |
| Safety Statements | 53-26-36/37/39-45-52 |
| WGK Germany | 3 |
| RTECS | VH6420000 |
| HS Code | 2924297099 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT SE 3 |





