A7710412
2,4,6-Tri-tert-butyl phenol , 99% , 732-26-3
Synonym(s):
P23;p35;p35nck5a;PSSALRE;Rosenthal fiber component
CAS NO.:732-26-3
Empirical Formula: C18H30O
Molecular Weight: 262.43
MDL number: MFCD00008821
EINECS: 211-989-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB25.60 | In Stock |
|
| 100G | RMB73.60 | In Stock |
|
| 500G | RMB292.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-130 °C (lit.) |
| Boiling point: | 277 °C (lit.) |
| Density | 0.8640 |
| vapor pressure | 0.073Pa at 25℃ |
| refractive index | 1.5029 (estimate) |
| Flash point: | 130 °C |
| storage temp. | -70°C |
| solubility | Chloroform (Slightly), DMSO (Slightly, Sonicated) |
| pka | 12.61±0.40(Predicted) |
| form | buffered aqueous glycerol solution |
| color | Off-White to Pale Yellow |
| biological source | rabbit |
| Water Solubility | insoluble |
| BRN | 1913256 |
| Specific Activity | 583-789nmol/min·mg |
| InChI | 1S/C18H30O/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9/h10-11,19H,1-9H3 |
| InChIKey | PFEFOYRSMXVNEL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C |
| LogP | 7.1 at 35℃ |
| CAS DataBase Reference | 732-26-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 2,4,6-tris(1,1-dimethylethyl)-(732-26-3) |
| EPA Substance Registry System | 2,4,6-Tris(tert-butyl)phenol (732-26-3) |
Description and Uses
2,4,6-Tri-tert-butylphenol is an antioxidant; used in preparation method of high-temperature resistant electromagnetic shielding electromagnetic bushing.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H317-H360D-H373-H410 |
| Precautionary statements | P202-P273-P280-P301+P312-P302+P352-P308+P313 |
| target organs | Liver |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | F,C,N,Xi,Xn |
| Risk Statements | 11-22-34-50-53-36/37/38-51/53 |
| Safety Statements | 26-36/37/39-45-60-61-24/25 |
| RIDADR | UN 2430 8/PG 3 |
| WGK Germany | 3 |
| RTECS | SN3570000 |
| F | 8-23 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29071990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B Skin Sens. 1B STOT RE 2 |
| Hazardous Substances Data | 732-26-3(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 1670mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








