A7711358
(-)-Epigallocatechin , 10mMinDMSO , 970-74-1
Synonym(s):
(−)-cis-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol;(−)-cis-3,3′,4′,5,5′,7-Hexahydroxyflavane;(−)-Epigallocatechin
CAS NO.:970-74-1
Empirical Formula: C15H14O7
Molecular Weight: 306.27
MDL number: MFCD00075939
EINECS: 619-254-4
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210°C |
| alpha | -50 º (c=0.04, EtOH) |
| Boiling point: | 685.6±55.0 °C(Predicted) |
| Density | 1.695±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.02±0.15(Predicted) |
| color | White to Light Beige |
| biological source | green tea |
| λmax | 278nm(MeOH)(lit.) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15-/m1/s1 |
| InChIKey | XMOCLSLCDHWDHP-IUODEOHRSA-N |
| SMILES | O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c3cc(O)c(O)c(O)c3 |
| LogP | -0.100 (est) |
| CAS DataBase Reference | 970-74-1(CAS DataBase Reference) |
Description and Uses
A natural product from green tea that induces apoptosis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | KB5100000 |
| F | 3-10 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |




