A7712258
β-Elemene , 10mMinDMSO , 515-13-9
Synonym(s):
β-Elemene;(1S,2S,4R)-(−)-2,4-Diisopropenyl-1-methyl-1-vinylcyclohexane;(1S,2S,4R)-1-Ethenyl-1-methyl-2,4-bis(1-methylethenyl)cyclohexane
CAS NO.:515-13-9
Empirical Formula: C15H24
Molecular Weight: 204.35
MDL number: MFCD00468041
EINECS: 679-283-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 252℃ |
| Density | 0.862 |
| Flash point: | 98℃ |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2) (1:2): 0.3 mg/ml |
| form | Liquid |
| color | Colorless to light yellow |
| Odor | at 100.00?%. sweet |
| BRN | 2207781 |
| Stability: | Volatile |
| Major Application | food and beverages |
| InChI | InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,13-14H,1-2,4,8-10H2,3,5-6H3/t13-,14+,15-/m1/s1 |
| InChIKey | OPFTUNCRGUEPRZ-RBSFLKMASA-N |
| SMILES | [C@@]1(C=C)(C)CC[C@@H](C(C)=C)C[C@H]1C(C)=C |
| LogP | 5.772 (est) |
Description and Uses
β-Elemene is an active constituent of Delonix regia and an anti-inflammatory agent. β-Elemene is a useful compound for investigating the toll-like receptor 4 signaling pathway and the inhibition of TNF-?a, IL-?1b, IL-?6 and IL-?12 expressions.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311-H332-H314-H335-H410-H227 |
| Precautionary statements | P501-P261-P273-P270-P210-P271-P264-P280-P370+P378-P391-P361+P364-P303+P361+P353-P301+P330+P331-P301+P310+P330-P304+P340+P310-P305+P351+P338+P310-P403+P233-P403+P235-P405 |
| Risk Statements | 66 |
| WGK Germany | 3 |
| RTECS | GU9660000 |
| Storage Class | 10 - Combustible liquids |






