A7713058
Marimastat(BB-2516) , 10mMinDMSO , 154039-60-8
Synonym(s):
(2S,3R)-N⁴-((1S)-2,2-Dimethyl-1-((methylamino)carbonyl)propyl)-N¹,2-hydroxy-3-(2-methylpropyl)butanediamide, BB-2516;BB2516, (2S,3R)-N4-[(1S)-2,2-Dimethyl-1-[(methylamino)carbonyl] propyl]-N1,2-dihydroxy-3-(2-methylpropyl)butanediamide;Marimastat - CAS 154039-60-8 - Calbiochem
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148℃ |
| Density | 1.140±0.06 g/cm3(Predicted) |
| RTECS | EJ6665000 |
| storage temp. | -20°C |
| solubility | DMSO: ≥20mg/mL |
| form | White solid |
| pka | 9.44±0.40(Predicted) |
| color | White to gray |
| InChI | 1S/C15H29N3O5/c1-8(2)7-9(10(19)13(21)18-23)12(20)17-11(14(22)16-6)15(3,4)5/h8-11,19,23H,7H2,1-6H3,(H,16,22)(H,17,20)(H,18,21)/t9-,10+,11-/m1/s1 |
| InChIKey | OCSMOTCMPXTDND-OUAUKWLOSA-N |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](O)C(=O)NO)C(C)(C)C |
Description and Uses
Marimastat acts as a matrix metalloproteinase inhibitor in the treatment of various cancers, and pathological occurrences such as arthritis and atherosclerosis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |





