A7717012
1,3,5-Tri-tert-butylbenzene , 98% , 1460-02-2
CAS NO.：1460-02-2
Empirical Formula: C18H30
Molecular Weight: 246.43
MDL number: MFCD00008831
EINECS: 215-952-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB87.20 | In Stock |
|
| 100G | RMB309.60 | In Stock |
|
| 500g | RMB1188.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-72 °C (lit.) |
| Boiling point: | 121-122 °C/12 mmHg (lit.) |
| Density | 0.8496 (estimate) |
| refractive index | 1.4948 (estimate) |
| Flash point: | 121-122°C/12mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| BRN | 1909579 |
| InChI | InChI=1S/C18H30/c1-16(2,3)13-10-14(17(4,5)6)12-15(11-13)18(7,8)9/h10-12H,1-9H3 |
| InChIKey | GUFMBISUSZUUCB-UHFFFAOYSA-N |
| SMILES | C1(C(C)(C)C)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 |
| CAS DataBase Reference | 1460-02-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3,5-tri-tert-butyl-(1460-02-2) |
Description and Uses
1,3,5-Tri-tert-butylbenzene is used in the preparation of sandwich complexes of scandium, yttrium and lanthanide ions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29029090 |
