A7723112
Tebuconazole , Analysis standard product, 99% , 107534-96-3
CAS NO.:107534-96-3
Empirical Formula: C16H22ClN3O
Molecular Weight: 307.82
MDL number: MFCD02674797
EINECS: 403-640-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB358.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-105°C |
| Boiling point: | 476.9±55.0 °C(Predicted) |
| Density | 1.25 |
| vapor pressure | 1.7 x l0-6 Pa (20 °C) |
| refractive index | 1.5800 (estimate) |
| Flash point: | 100 °C |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform: Slightly Soluble; Methanol: Slightly Soluble |
| form | Solid |
| pka | 13.70±0.29(Predicted) |
| color | White to Almost white |
| Water Solubility | 32 mg/L at 20 ºC |
| Merck | 14,9092 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C16H22ClN3O/c1-15(2,3)16(10-21,20-12-18-11-19-20)9-8-13-4-6-14(17)7-5-13/h4-7,11-12,21H,8-10H2,1-3H3 |
| InChIKey | PXMNMQRDXWABCY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(CO)(CCc1ccc(Cl)cc1)n2cncn2 |
| LogP | 3.700 |
| CAS DataBase Reference | 107534-96-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Tebuconazole(107534-96-3) |
| EPA Substance Registry System | Tebuconazole (107534-96-3) |
Description and Uses
Ergosterol biosynthesis inhibitor. Fungicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H361d-H410 |
| Precautionary statements | P201-P202-P264-P273-P301+P312-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 22-51/53-63 |
| Safety Statements | 2-22-36/37-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | XZ4803270 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 |
| Hazardous Substances Data | 107534-96-3(Hazardous Substances Data) |
| Toxicity | bird - domestic,LD50,oral,> 1gm/kg (1000mg/kg),Pesticide Manual. Vol. 9, Pg. 785, 1991. |








