A7723812
2,3,5-Trichloropyridine , 99% , 16063-70-0
CAS NO.:16063-70-0
Empirical Formula: C5H2Cl3N
Molecular Weight: 182.44
MDL number: MFCD00043007
EINECS: 407-270-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10G | RMB38.40 | In Stock |
|
| 25G | RMB63.20 | In Stock |
|
| 50G | RMB124.00 | In Stock |
|
| 100G | RMB167.20 | In Stock |
|
| 250G | RMB287.20 | In Stock |
|
| 500g | RMB567.20 | In Stock |
|
| 1kg | RMB948.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-50 °C (lit.) |
| Boiling point: | 219 °C (lit.) |
| Density | 1.539±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -2.92±0.10(Predicted) |
| form | Solid |
| color | Off-white to pale yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 119384 |
| InChI | InChI=1S/C5H2Cl3N/c6-3-1-4(7)5(8)9-2-3/h1-2H |
| InChIKey | CNLIIAKAAMFCJG-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 16063-70-0(CAS DataBase Reference) |
Description and Uses
2,3,5-Trichloropyridine may be used in the synthesis of 3,5-dichloro-2-arylpyridines via palladium acetate-catalyzed ligand-free Suzuki reaction with arylboronic acids.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H317-H318-H412 |
| Precautionary statements | P261-P273-P280-P301+P310-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 52/53-36/37/38 |
| Safety Statements | 61-37/39-26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | UU0525000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 3 Eye Dam. 1 Skin Sens. 1 |
| Toxicity | mouse,LD50,intraperitoneal,430mg/kg (430mg/kg),BEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY)LIVER: FATTY LIVER DEGERATIONBEHAVIORAL: ANTIPSYCHOTIC,Toxicology and Applied Pharmacology. Vol. 11, Pg. 361, 1967. |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






