A7730912
Thiobenzamide , 98% , 2227-79-4
CAS NO.:2227-79-4
Empirical Formula: C7H7NS
Molecular Weight: 137.2
MDL number: MFCD00008060
EINECS: 218-765-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB65.60 | In Stock |
|
| 100G | RMB239.20 | In Stock |
|
| 250G | RMB551.20 | In Stock |
|
| 500g | RMB1061.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-117 °C (lit.) |
| Boiling point: | 180 °C |
| Density | 1.1364 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | 120°C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 12.68±0.29(Predicted) |
| form | Crystalline Powder |
| color | yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 606021 |
| InChI | InChI=1S/C7H7NS/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
| InChIKey | QIOZLISABUUKJY-UHFFFAOYSA-N |
| SMILES | C1(C(N)=S)=CC=CC=C1 |
| CAS DataBase Reference | 2227-79-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenecarbothioamide (2227-79-4) |
Description and Uses
Thiobenzamide was used to prepare amide and amidine adducts. It was also used in the synthesis of 4-oxo-4H-chromene-3-carbothioic acid N-phenylamides.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45-24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CV5860000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | mnt-mus-orl 180 mmol/kg MUREAV 192,141,87 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







