A7732358
6-Ethoxy-2-benzothiazolesulfonamide , 10mMinDMSO , 452-35-7
Synonym(s):
6-Ethoxyzolamide;Ethoxzolamide
CAS NO.:452-35-7
Empirical Formula: C9H10N2O3S2
Molecular Weight: 258.32
MDL number: MFCD00057089
EINECS: 207-199-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-193 °C(lit.) |
| Boiling point: | 464.9±37.0 °C(Predicted) |
| Density | 1.4767 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly) |
| pka | pKa 8.12(H2O t=25.0) (Uncertain) |
| form | Solid |
| color | Off-White |
| Water Solubility | 10.33mg/L(25 ºC) |
| Merck | 13,3790 |
| InChI | InChI=1S/C9H10N2O3S2/c1-2-14-6-3-4-7-8(5-6)15-9(11-7)16(10,12)13/h3-5H,2H2,1H3,(H2,10,12,13) |
| InChIKey | OUZWUKMCLIBBOG-UHFFFAOYSA-N |
| SMILES | S1C2=CC(OCC)=CC=C2N=C1S(N)(=O)=O |
Description and Uses
Ethoxzolamide is used in the treatment of glaucoma, and is also used as a diuretic, acting as a carbonic anhydrase inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | DL6390000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 452-35-7(Hazardous Substances Data) |



![5-Methoxybenzo[d]thiazole](https://img.chemicalbook.com/CAS/GIF/2942-14-5.gif)


