A7733258
Hydrocortisonehydrogensuccinate , 10mMinDMSO , 2203-97-6
Synonym(s):
11β,17α,21-Trihydroxy-4-pregnene-3,20-dione 21-hemisuccinate;11β,17aα,21-Trihydroxy-4-pregnene-3,20-dione 21-hemisuccinate;Cortisol 21-hemisuccinate;Hydrocortisone 21-hemisuccinate;Hydrocortisone 21-hemisuccinate monohydrate
CAS NO.:2203-97-6
Empirical Formula: C25H34O8
Molecular Weight: 462.53
MDL number: MFCD00046256
EINECS: 218-612-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170~172℃ |
| alpha | [α]D20 +147~+153° (c=1, C2H5OH) (After Drying) |
| Boiling point: | 685.5±55.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Practically insoluble in water, freely soluble in acetone and in anhydrous ethanol. It dissolves in dilute solutions of alkali carbonates and alkali hydroxides. |
| form | Solid |
| pka | pKa 5.10/5.64(20% aq EtOH/50% aq EtOH) (Uncertain) |
| color | White to Off-White |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | VWQWXZAWFPZJDA-CGVGKPPMSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@H]3[C@@H]4CC[C@](O)(C(=O)COC(=O)CCC(O)=O)[C@@]4(C)C[C@H](O)[C@H]23 |
Description and Uses
glucocorticoid
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360D |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | TU5010147 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |






