A7733658
Fosphenytoindisodiumsalt , 10mMinDMSO , 92134-98-0
Synonym(s):
5,5-Diphenyl-3-[(phosphonooxy)methyl]-2,4-imidazolidinedione disodium salt;5,5-Diphenyl-3-[(phosphonooxy)methyl]-2,4-imidazolidinedione disodium salt hydrate;Fosphenytoin disodium salt
CAS NO.：92134-98-0
Empirical Formula: C16H16N2NaO6P
Molecular Weight: 386.28
MDL number: MFCD00948765
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220° (softens) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | H2O: ≥15mg/mL |
| form | powder |
| color | white to tan |
| Water Solubility | H2O: ≥15mg/mL |
| InChI | InChI=1S/C16H15N2O6P.Na.H/c19-14-16(12-7-3-1-4-8-12,13-9-5-2-6-10-13)17-15(20)18(14)11-24-25(21,22)23;;/h1-10H,11H2,(H,17,20)(H2,21,22,23);; |
| InChIKey | JOJPAZCANKNCBW-UHFFFAOYSA-N |
| SMILES | O=C1N(C(=O)NC1(C1C=CC=CC=1)C1C=CC=CC=1)COP(O)(O)=O.[NaH] |
Description and Uses
Anti epileptic
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H350-H360 |
| Precautionary statements | P201-P301+P312+P330-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 45-61-22 |
| Safety Statements | 53-36/37-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933290000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B Repr. 1B |
| Toxicity | LD50 in mice, rats (mg/kg): 234, 363 i.v. (Smith) |
