A7735012
Mannose triflate , 98% , 92051-23-5
Synonym(s):
β-D -Mannopyranose 1,3,4,6-tetra-O-acetate 2-O-trifluoromethanesulfonate;1,3,4,6-Tetra-O-acetyl-2-O-trifluoromethanesulfonyl-β-D -mannopyranose;Mannose triflate;TATM
CAS NO.:92051-23-5
Empirical Formula: C15H19F3O12S
Molecular Weight: 480.36
MDL number: MFCD00012353
EINECS: 200-001-8
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB319.20 | In Stock |
|
| 250mg | RMB639.20 | In Stock |
|
| 500MG | RMB1119.20 | In Stock |
|
| 1g | RMB1839.20 | In Stock |
|
| 5g | RMB6399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-122 °C |
| alpha | [α]D20 -14~-17゜(c=1,CHCl3) |
| Boiling point: | 481.6±45.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| refractive index | -16 ° (C=1, CHCl3) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]22/D -16°, c = 1 in chloroform |
| BRN | 4341413 |
| InChI | InChI=1/C15H19F3O12S/c1-6(19)25-5-10-11(26-7(2)20)12(27-8(3)21)13(14(29-10)28-9(4)22)30-31(23,24)15(16,17)18/h10-14H,5H2,1-4H3/t10-,11-,12+,13+,14-/s3 |
| InChIKey | OIBDVHSTOUGZTJ-UBBZJQTNNA-N |
| SMILES | [C@H]1(OC(=O)C)[C@H](OC(=O)C)[C@H](O[C@@H](OC(=O)C)[C@H]1OS(=O)(=O)C(F)(F)F)COC(=O)C |&1:0,5,10,12,17,r| |
Description and Uses
Mannose triflate is a glucose analog. Mannose triflate is a well-known precursor for 18F-FDG synthesis for PET applications. 18F-FDG is an imaging technique for cancer.
1,3,4,6-Tetra-O-acetyl-2-O-trifluoromethanesulfonyl-beta-D-mannopyranose is a radiolabelled pharmaceutical preparation for diagnostic aims used in positron emission tomography.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280-P271 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |







