A7738412
triisopropanolamine cyclic borate , 98% , 101-00-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB264.80 | In Stock |
|
| 100G | RMB596.80 | In Stock |
|
| 500g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150 °C |
| Boiling point: | 135°C/0.2mmHg(lit.) |
| Density | 1.05±0.1 g/cm3(Predicted) |
| solubility | soluble in Acetone |
| pka | 6.52±0.70(Predicted) |
| form | Crystalline Chunks and Needles |
| color | White to light yellow |
| InChI | InChI=1S/C9H18BNO3/c1-7-4-11-5-8(2)13-10(12-7)14-9(3)6-11/h7-9H,4-6H2,1-3H3 |
| InChIKey | IWKGJTDSJPLUCE-UHFFFAOYSA-N |
| SMILES | B12OC(C)CN(CC(C)O1)CC(C)O2 |
| CAS DataBase Reference | 101-00-8(CAS DataBase Reference) |
Description and Uses
Triisopropanolamine cyclic borate can be used as a gasoline corrosion inhibitor, metal working fluid, gasoline dehydrating agent, polysiloxane elastic rubber stabilizer, adhesive, and polymer crosslinking agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H320 |
| Precautionary statements | P264-P305+P351+P338+P337+P313 |
| Safety Statements | 24/25 |
| RTECS | ED5787000 |
| HS Code | 29163990 |





