BD9568355
Triisopropoxyvanadium(V)Oxide , 98% , 5588-84-1
Synonym(s):
Triisopropoxyvanadium(V) oxide;Vanadium(V) trisisopropoxide oxide;VTIP
CAS NO.:5588-84-1
Empirical Formula: C9H21O4V
Molecular Weight: 244.2
MDL number: MFCD00015017
EINECS: 226-997-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB1568.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -11°C |
| Boiling point: | 80-82 °C2 mm Hg(lit.) |
| Density | 1.035 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 113 °F |
| storage temp. | Flammables area |
| solubility | Miscible with toluene, hexane and isopropanol. |
| form | Liquid |
| Specific Gravity | 1.035 |
| color | Pale yellow-orange |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| Exposure limits | NIOSH: Ceiling 0.05 mg/m3 |
| InChI | 1S/3C3H7O.O.V/c3*1-3(2)4;;/h3*3H,1-2H3;;/q3*-1;;+3 |
| InChIKey | DSGGJXAUQHKOGQ-UHFFFAOYSA-N |
| SMILES | CC(C)O[V](=O)(OC(C)C)OC(C)C |
| CAS DataBase Reference | 5588-84-1(CAS DataBase Reference) |
| EPA Substance Registry System | Vanadium, oxotris(2-propanolato)-, (T-4)- (5588-84-1) |
Description and Uses
Vanadium(V) triisopropoxide oxide serves as a building block for a series of neutral oxovanadium complexes containing both ethoxide and acetylacetonate ligands. It is also used in catalysis. Further, it acts as a precursor and used in thermal atomic layer deposition of vanadium pentoxide.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-27 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29055900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |







