A7740358
Levobupivacaine , 10mMinDMSO , 27262-47-1
CAS NO.:27262-47-1
Empirical Formula: C18H28N2O
Molecular Weight: 288.43
MDL number: MFCD00936851
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-137°C |
| alpha | D25 -80.9° (c = 5 in methanol) |
| Boiling point: | 430.65°C (rough estimate) |
| Density | 1.0238 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO:58.0(Max Conc. mg/mL);201.09(Max Conc. mM) Ethanol:58.0(Max Conc. mg/mL);201.09(Max Conc. mM) |
| pka | 14.85±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | LEBVLXFERQHONN-INIZCTEOSA-N |
| SMILES | O=C(NC1=C(C)C=CC=C1C)[C@@]2([H])N(CCCC)CCCC2 |
Description and Uses
Local anaesthetic used for epidural and intrathecal anaesthesia.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H330-H301-H311 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P280-P302+P352-P312-P322-P361-P363-P405-P501-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |





