A7742512
1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane , 98% , 41203-22-9
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB408.80 | In Stock |
|
| 1G | RMB1171.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-42 °C(lit.) |
| Boiling point: | 130-135℃ (0.2 Torr) |
| Density | 0.9798 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 8.96±0.20(Predicted) |
| form | crystal |
| color | white waxy |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 1210788 |
| InChI | 1S/C14H32N4/c1-15-7-5-8-17(3)13-14-18(4)10-6-9-16(2)12-11-15/h5-14H2,1-4H3 |
| InChIKey | HRFJEOWVAGSJNW-UHFFFAOYSA-N |
| SMILES | CN1CCCN(C)CCN(C)CCCN(C)CC1 |
| CAS DataBase Reference | 41203-22-9(CAS DataBase Reference) |
Description and Uses
1,4,8,11-Tetramethyl-1,4,8,11-tetraazacyclotetradecane is used as a macrocyclic chelating agent in coordination chemistry. It is also used as a ligand which bind strongly to a wide range of metal ions and as crown ethers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | XA5255700 |
| F | 3-9-34 |
| HS Code | 2933.99.9701 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






