A7743558
khellin , 10mMinDMSO , 82-02-0
Synonym(s):
4,9-Dimethoxy-7-methyl-5H-furo[3,2-g][1]benzopyran-5-one
CAS NO.:82-02-0
Empirical Formula: C14H12O5
Molecular Weight: 260.24
MDL number: MFCD00005007
EINECS: 201-392-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150154°C |
| Boiling point: | 180200°C0.05mm Hg |
| Density | 1.1954 (rough estimate) |
| refractive index | 1.4560 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | crystalline |
| color | light yellow |
| Water Solubility | 247.2g/L(25 ºC) |
| Merck | 14,5309 |
| BRN | 263185 |
| Major Application | food and beverages |
| InChI | 1S/C14H12O5/c1-7-6-9(15)10-11(16-2)8-4-5-18-12(8)14(17-3)13(10)19-7/h4-6H,1-3H3 |
| InChIKey | HSMPDPBYAYSOBC-UHFFFAOYSA-N |
| SMILES | COc1c2OC(C)=CC(=O)c2c(OC)c3ccoc13 |
| LogP | 1.770 (est) |
| EPA Substance Registry System | Khellin (82-02-0) |
Description and Uses
vasodilator (coronary), photosensitizer
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | T |
| Risk Statements | 25-38-36/37/38-23/24/25 |
| Safety Statements | 36/37/39-45-26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | LV1050000 |
| HS Code | 2932.99.7000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 in mice, rats (mg/kg): 30.6, 34.4 i.v.; 50.8, 68.8 orally (Busch) |



![(2S,5R,6R)-6-[(R)-2-Amino-2-phenylacetamido]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/69-53-4.gif)
