A7744512
3,6,9-Trioxaundecanedioic acid , Industrial grade, 70% , 13887-98-4
Synonym(s):
O,O′-Oxydiethylene-diglycolic acid
CAS NO.:13887-98-4
Empirical Formula: C8H14O7
Molecular Weight: 222.19
MDL number: MFCD00044099
EINECS: 237-655-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB191.20 | In Stock |
|
| 25G | RMB676.00 | In Stock |
|
| 100G | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 443.7±30.0 °C(Predicted) |
| Density | 1.3 g/mL at 20 °C(lit.) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | n |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Water, DMSO, DCM, DMF |
| form | Solid-Liquid Mixture |
| pka | 3.09±0.10(Predicted) |
| color | Off-white to yellow |
| PH | 1.8 (100g/l, H2O) |
| BRN | 1962084 |
| Cosmetics Ingredients Functions | HUMECTANT |
| InChI | InChI=1S/C8H14O7/c9-7(10)5-14-3-1-13-2-4-15-6-8(11)12/h1-6H2,(H,9,10)(H,11,12) |
| InChIKey | HJZZQNLKBWJYPD-UHFFFAOYSA-N |
| SMILES | O(CCOCC(O)=O)CCOCC(O)=O |
| LogP | -2.56 at 25℃ |
Description and Uses
PEG3-(CH2CO2H)2 is a PEG linker containing two terminal carboxylic acid groups. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acids can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond.
369-Trioxaundecanedioic Acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| RIDADR | 1760 |
| WGK Germany | 1 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 |






