BD1347532
3,6-Dioxaoctanedioic acid , 97% , 23243-68-7
CAS NO.:23243-68-7
Empirical Formula: C6H10O6
Molecular Weight: 178.14
MDL number: MFCD00054502
EINECS: 245-516-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB77.60 | In Stock |
|
| 1g | RMB197.60 | In Stock |
|
| 5g | RMB552.00 | In Stock |
|
| 10g | RMB935.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-71℃ |
| Boiling point: | 429.2±25.0 °C(Predicted) |
| Density | 1.375 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 3.09±0.10(Predicted) |
| form | solid |
| color | White to off-white |
| InChI | InChI=1S/C6H10O6/c7-5(8)3-11-1-2-12-4-6(9)10/h1-4H2,(H,7,8)(H,9,10) |
| InChIKey | CQWXKASOCUAEOW-UHFFFAOYSA-N |
| SMILES | C(OCC(O)=O)COCC(O)=O |
| LogP | -2.29 at 25℃ |
Description and Uses
PEG2-(CH2CO2H)2 is a PEG linker containing two terminal carboxylic acid groups. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acids can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond.
3,6-Dioxaoctanedioic acid can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P312 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-27-22 |
| RIDADR | 3261 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2917198090 |






