A7749912
1,5,5-Trimethylhydantoin , 98% , 6851-81-6
Synonym(s):
1,5,5-Trimethyl-2,4-imidazolidinedione;3,4,4-Trimethyl-2,5-dioxoimidazolidine
CAS NO.:6851-81-6
Empirical Formula: C6H10N2O2
Molecular Weight: 142.16
MDL number: MFCD00040439
EINECS: 229-945-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB144.80 | In Stock |
|
| 5G | RMB337.60 | In Stock |
|
| 25G | RMB1120.00 | In Stock |
|
| 100g | RMB3562.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161-164 °C (lit.) |
| Boiling point: | 259.72°C (rough estimate) |
| Density | 1.2298 (rough estimate) |
| refractive index | 1.5010 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 8.99±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C6H10N2O2/c1-6(2)4(9)7-5(10)8(6)3/h1-3H3,(H,7,9,10) |
| InChIKey | ZNYIPTYJBRGSSL-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C)C(C)(C)C(=O)N1 |
| CAS DataBase Reference | 6851-81-6(CAS DataBase Reference) |
Description and Uses
1,5,5-Trimethylhydantoin (1,5,5-Trimethyl-imidazolidine-2,4-dione) may be used to synthesize 3-bromomethyl-1,5,5-trimethylimidazolid-ine-2,4-dione.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |





