A7750012
Thiobencarb , Analysis of standard products, 97% , 28249-77-6
Synonym(s):
Benthiocarb
CAS NO.:28249-77-6
Empirical Formula: C12H16ClNOS
Molecular Weight: 257.78
MDL number: MFCD00055475
EINECS: 248-924-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB375.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 1.7°C |
| Boiling point: | 126-129°C |
| Density | 1.0756 (rough estimate) |
| refractive index | 1.5630 (estimate) |
| storage temp. | APPROX 4°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | -1.26±0.70(Predicted) |
| form | Liquid |
| color | Pale yellow |
| Water Solubility | 30mg/L(22 ºC) |
| BRN | 1968440 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C12H16ClNOS/c1-3-14(4-2)12(15)16-9-10-5-7-11(13)8-6-10/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | QHTQREMOGMZHJV-UHFFFAOYSA-N |
| SMILES | C(SCC1=CC=C(Cl)C=C1)(=O)N(CC)CC |
| CAS DataBase Reference | 28249-77-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benthiocarb(28249-77-6) |
| EPA Substance Registry System | Thiobencarb (28249-77-6) |
Description and Uses
Thiocarbamate herbicide used to control sedges and grasses in rice paddies.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3082 |
| WGK Germany | 3 |
| RTECS | EZ7260000 |
| HS Code | 29302000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 28249-77-6(Hazardous Substances Data) |
| Toxicity | chicken,LD50,oral,673mg/kg (673mg/kg),Japan Pesticide Information. Vol. (19), Pg. 21, 1974. |





