A7750158
EcliptasaponinA , 10mMinDMSO , 78285-90-2
CAS NO.：78285-90-2
Empirical Formula: C36H58O9
Molecular Weight: 634.84
MDL number: MFCD00017386
EINECS: 278-887-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237～238℃ |
| Boiling point: | 752.6±60.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | Soluble in methan |
| pka | 4.42±0.70(Predicted) |
| form | Solid |
| color | White |
| BRN | 1613820 |
| InChIKey | WYDPEADEZMZKNM-ZBKPBKBGSA-N |
| SMILES | CC1(C)CC[C@@]2([C@H](O)C[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]2C1)C(O)=O |
| LogP | 5.610 (est) |
Description and Uses
Ecliptasaponin A has anti-tumor and immunological properties, it can be used for determination/identification/pharmacological experiments, etc.
Safety
| WGK Germany | 3 |
| HS Code | 29389090 |
| Storage Class | 13 - Non Combustible Solids |
